| Name | 3,5-diiodo-L-tyrosine dihydrate |
| Synonyms | 3 5-DIIODO-L-TYROSINE DIH DI-Iodo-L-Tyrosine Dihydrate 3,5-Diiodo-L-tyrosine hydrate 3,5-diiodo-l-tyrosinedihydride 3,5-diiodo-L-tyrosine dihydrate 3 5-DIIODO-L-TYROSINE DIHYDRATE 98 3,5-Diiodo-L-tyrosine dihydrate crystalline (S)-2-AMino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid dihydrate |
| CAS | 18835-59-1 |
| EINECS | 629-243-6 |
| InChI | InChI=1/C9H9I2NO3.2H2O/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15;;/h1-2,7,13H,3,12H2,(H,14,15);2*1H2/t7-;;/m0../s1 |
| Molecular Formula | C9H13I2NO5 |
| Molar Mass | 469.01216 |
| Melting Point | 185°C |
| Boling Point | 410.5°C at 760 mmHg |
| Flash Point | 202.1°C |
| Vapor Presure | 1.78E-07mmHg at 25°C |
| Appearance | crystalline |
| Color | white |
| BRN | 2218691 |
| Storage Condition | -20°C |
| Sensitive | Light Sensitive |
| Physical and Chemical Properties | Storage Conditions:? 20 ℃ sensitivity: Light Sensitive |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| TSCA | Yes |
| Biological activity | (S)-2-Amino-3-(4-hydroxy-3,5-diiodophenyl)propanoic acid dihydrate is an endogenous metabolite. |